C16H26ClNO4 — CID 66532270
2-[2-[(2-chloro-5-ethoxy-4-propoxyphenyl)methylamino]ethoxy]ethanol (PubChem CID 66532270) has the molecular formula C16H26ClNO4 and a molecular weight of 331.84 g/mol. Its IUPAC name is 2-[2-[(2-chloro-5-ethoxy-4-propoxyphenyl)methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[(2-chloro-5-ethoxy-4-propoxyphenyl)methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 66532270 |
| Molecular Formula | C16H26ClNO4 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[2-[(2-chloro-5-ethoxy-4-propoxyphenyl)methylamino]ethoxy]ethanol |
| SMILES | CCCOc1cc(Cl)c(CNCCOCCO)cc1OCC |
| InChI | InChI=1S/C16H26ClNO4/c1-3-7-22-16-11-14(17)13(10-15(16)21-4-2)12-18-5-8-20-9-6-19/h10-11,18-19H,3-9,12H2,1-2H3 |
| InChIKey | OZWOWCRJXWGZHP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|