C17H29ClN2O3 — CID 66537972
2-[3-[(2-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]propylamino]ethanol (PubChem CID 66537972) has the molecular formula C17H29ClN2O3 and a molecular weight of 344.88 g/mol. Its IUPAC name is 2-[3-[(2-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]propylamino]ethanol.
| Compound Name | 2-[3-[(2-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]propylamino]ethanol |
|---|---|
| PubChem CID | 66537972 |
| Molecular Formula | C17H29ClN2O3 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[3-[(2-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]propylamino]ethanol |
| SMILES | CCOc1cc(CNCCCNCCO)c(Cl)cc1OC(C)C |
| InChI | InChI=1S/C17H29ClN2O3/c1-4-22-16-10-14(12-20-7-5-6-19-8-9-21)15(18)11-17(16)23-13(2)3/h10-11,13,19-21H,4-9,12H2,1-3H3 |
| InChIKey | POQFOPPHXUKOAA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|