C20H27ClN2O3 — CID 66537637
2-[2-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]ethylamino]ethanol (PubChem CID 66537637) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-[2-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]ethylamino]ethanol.
| Compound Name | 2-[2-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]ethylamino]ethanol |
|---|---|
| PubChem CID | 66537637 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-[2-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]ethylamino]ethanol |
| SMILES | CCOc1cc(CNCCNCCO)c(Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H27ClN2O3/c1-2-25-19-12-17(14-23-9-8-22-10-11-24)18(21)13-20(19)26-15-16-6-4-3-5-7-16/h3-7,12-13,22-24H,2,8-11,14-15H2,1H3 |
| InChIKey | MDXGBQMUFRUIGQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|