C21H27Cl3N2O3 — CID 66537534
2-[3-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propylamino]ethanol (PubChem CID 66537534) has the molecular formula C21H27Cl3N2O3 and a molecular weight of 461.82 g/mol. Its IUPAC name is 2-[3-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propylamino]ethanol.
| Compound Name | 2-[3-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propylamino]ethanol |
|---|---|
| PubChem CID | 66537534 |
| Molecular Formula | C21H27Cl3N2O3 |
| Molecular Weight | 461.82 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 2-[3-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propylamino]ethanol |
| SMILES | CCOc1cc(CNCCCNCCO)c(Cl)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H27Cl3N2O3/c1-2-28-20-10-16(13-26-7-3-6-25-8-9-27)19(24)12-21(20)29-14-15-4-5-17(22)11-18(15)23/h4-5,10-12,25-27H,2-3,6-9,13-14H2,1H3 |
| InChIKey | ROEQRUYSMCTLEN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|