C24H22Cl5NO2 — CID 66531220
N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 66531220) has the molecular formula C24H22Cl5NO2 and a molecular weight of 533.71 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 66531220 |
| Molecular Formula | C24H22Cl5NO2 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | CCOc1cc(CNCCc2ccc(Cl)cc2Cl)c(Cl)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H22Cl5NO2/c1-2-31-23-9-17(13-30-8-7-15-3-5-18(25)10-20(15)27)22(29)12-24(23)32-14-16-4-6-19(26)11-21(16)28/h3-6,9-12,30H,2,7-8,13-14H2,1H3 |
| InChIKey | OQFJCIRWBXSBIN-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|