C24H24Cl3NO2 — CID 66530676
N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(4-chlorophenyl)ethanamine (PubChem CID 66530676) has the molecular formula C24H24Cl3NO2 and a molecular weight of 464.82 g/mol. Its IUPAC name is N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(4-chlorophenyl)ethanamine.
| Compound Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(4-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 66530676 |
| Molecular Formula | C24H24Cl3NO2 |
| Molecular Weight | 464.82 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(4-chlorophenyl)ethanamine |
| SMILES | CCOc1cc(CNCCc2ccc(Cl)cc2)c(Cl)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24Cl3NO2/c1-2-29-23-13-19(15-28-12-11-17-3-7-20(25)8-4-17)22(27)14-24(23)30-16-18-5-9-21(26)10-6-18/h3-10,13-14,28H,2,11-12,15-16H2,1H3 |
| InChIKey | OLDKJXYZQFDNKR-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.82 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|