C16H16Cl2O3 — CID 66529304
[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methanol (PubChem CID 66529304) has the molecular formula C16H16Cl2O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is [2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methanol.
| Compound Name | [2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methanol |
|---|---|
| PubChem CID | 66529304 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methanol |
| SMILES | CCOc1cc(CO)c(Cl)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2O3/c1-2-20-15-7-12(9-19)14(18)8-16(15)21-10-11-3-5-13(17)6-4-11/h3-8,19H,2,9-10H2,1H3 |
| InChIKey | LSTWZCHHYQSDOB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |