C14H12Cl2O2 — CID 57425039
(2,4-dichloro-5-phenylmethoxyphenyl)methanol (PubChem CID 57425039) has the molecular formula C14H12Cl2O2 and a molecular weight of 283.15 g/mol. Its IUPAC name is (2,4-dichloro-5-phenylmethoxyphenyl)methanol.
| Compound Name | (2,4-dichloro-5-phenylmethoxyphenyl)methanol |
|---|---|
| PubChem CID | 57425039 |
| Molecular Formula | C14H12Cl2O2 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | (2,4-dichloro-5-phenylmethoxyphenyl)methanol |
| SMILES | OCc1cc(OCc2ccccc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2O2/c15-12-7-13(16)14(6-11(12)8-17)18-9-10-4-2-1-3-5-10/h1-7,17H,8-9H2 |
| InChIKey | SZDPYXFIXAITCM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |