C16H18O4 — CID 53441132
(4,5-dimethoxy-2-phenylmethoxyphenyl)methanol (PubChem CID 53441132) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (4,5-dimethoxy-2-phenylmethoxyphenyl)methanol.
| Compound Name | (4,5-dimethoxy-2-phenylmethoxyphenyl)methanol |
|---|---|
| PubChem CID | 53441132 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (4,5-dimethoxy-2-phenylmethoxyphenyl)methanol |
| SMILES | COc1cc(CO)c(OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C16H18O4/c1-18-15-8-13(10-17)14(9-16(15)19-2)20-11-12-6-4-3-5-7-12/h3-9,17H,10-11H2,1-2H3 |
| InChIKey | HEQYOBNRUFXZPG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |