C18H23NO4 — CID 170892300
2-amino-3-(4,5-dimethoxy-2-phenylmethoxyphenyl)propan-1-ol (PubChem CID 170892300) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-amino-3-(4,5-dimethoxy-2-phenylmethoxyphenyl)propan-1-ol.
| Compound Name | 2-amino-3-(4,5-dimethoxy-2-phenylmethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 170892300 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-amino-3-(4,5-dimethoxy-2-phenylmethoxyphenyl)propan-1-ol |
| SMILES | COc1cc(CC(N)CO)c(OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H23NO4/c1-21-17-9-14(8-15(19)11-20)16(10-18(17)22-2)23-12-13-6-4-3-5-7-13/h3-7,9-10,15,20H,8,11-12,19H2,1-2H3 |
| InChIKey | ZOXWRRMCAQZYON-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |