C12H19NO3 — CID 176947219
2-amino-3-(2,5-dimethoxy-4-methylphenyl)propan-1-ol (PubChem CID 176947219) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-amino-3-(2,5-dimethoxy-4-methylphenyl)propan-1-ol.
| Compound Name | 2-amino-3-(2,5-dimethoxy-4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 176947219 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2-amino-3-(2,5-dimethoxy-4-methylphenyl)propan-1-ol |
| SMILES | COc1cc(CC(N)CO)c(OC)cc1C |
| InChI | InChI=1S/C12H19NO3/c1-8-4-12(16-3)9(5-10(13)7-14)6-11(8)15-2/h4,6,10,14H,5,7,13H2,1-3H3 |
| InChIKey | GYSVQPMAYKEBLU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |