C10H13F2NO2 — CID 170893663
2-amino-3-(2,3-difluoro-4-methoxyphenyl)propan-1-ol (PubChem CID 170893663) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-amino-3-(2,3-difluoro-4-methoxyphenyl)propan-1-ol.
| Compound Name | 2-amino-3-(2,3-difluoro-4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 170893663 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-amino-3-(2,3-difluoro-4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CC(N)CO)c(F)c1F |
| InChI | InChI=1S/C10H13F2NO2/c1-15-8-3-2-6(4-7(13)5-14)9(11)10(8)12/h2-3,7,14H,4-5,13H2,1H3 |
| InChIKey | OYEVLXMXGRHQTG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |