C11H17NO3 — CID 82394614
2-amino-3-(2,3-dimethoxyphenyl)propan-1-ol (PubChem CID 82394614) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-amino-3-(2,3-dimethoxyphenyl)propan-1-ol.
| Compound Name | 2-amino-3-(2,3-dimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 82394614 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-amino-3-(2,3-dimethoxyphenyl)propan-1-ol |
| SMILES | COc1cccc(CC(N)CO)c1OC |
| InChI | InChI=1S/C11H17NO3/c1-14-10-5-3-4-8(11(10)15-2)6-9(12)7-13/h3-5,9,13H,6-7,12H2,1-2H3 |
| InChIKey | LFEPGNHRQUAMHP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |