C15H14F3NO2 — CID 170893583
2-amino-3-[2-(2,4-difluorophenoxy)-5-fluorophenyl]propan-1-ol (PubChem CID 170893583) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-amino-3-[2-(2,4-difluorophenoxy)-5-fluorophenyl]propan-1-ol.
| Compound Name | 2-amino-3-[2-(2,4-difluorophenoxy)-5-fluorophenyl]propan-1-ol |
|---|---|
| PubChem CID | 170893583 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-amino-3-[2-(2,4-difluorophenoxy)-5-fluorophenyl]propan-1-ol |
| SMILES | NC(CO)Cc1cc(F)ccc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C15H14F3NO2/c16-10-1-3-14(9(5-10)6-12(19)8-20)21-15-4-2-11(17)7-13(15)18/h1-5,7,12,20H,6,8,19H2 |
| InChIKey | GVXHEHRQQWIRRG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |