C15H13F4N — CID 64561196
1,3-bis(2,4-difluorophenyl)propan-2-amine (PubChem CID 64561196) has the molecular formula C15H13F4N and a molecular weight of 283.27 g/mol. Its IUPAC name is 1,3-bis(2,4-difluorophenyl)propan-2-amine.
| Compound Name | 1,3-bis(2,4-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 64561196 |
| Molecular Formula | C15H13F4N |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1,3-bis(2,4-difluorophenyl)propan-2-amine |
| SMILES | NC(Cc1ccc(F)cc1F)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H13F4N/c16-11-3-1-9(14(18)7-11)5-13(20)6-10-2-4-12(17)8-15(10)19/h1-4,7-8,13H,5-6,20H2 |
| InChIKey | SKYUSZWNBWDYFW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |