C15H17F2NS — CID 64561389
1-(2,4-difluorophenyl)-3-(5-ethylthiophen-2-yl)propan-2-amine (PubChem CID 64561389) has the molecular formula C15H17F2NS and a molecular weight of 281.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(5-ethylthiophen-2-yl)propan-2-amine.
| Compound Name | 1-(2,4-difluorophenyl)-3-(5-ethylthiophen-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 64561389 |
| Molecular Formula | C15H17F2NS |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(5-ethylthiophen-2-yl)propan-2-amine |
| SMILES | CCc1ccc(CC(N)Cc2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C15H17F2NS/c1-2-13-5-6-14(19-13)9-12(18)7-10-3-4-11(16)8-15(10)17/h3-6,8,12H,2,7,9,18H2,1H3 |
| InChIKey | XESCMHCIOBGYJU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |