C11H16F3NS — CID 79952744
1-(5-ethylthiophen-2-yl)-5,5,5-trifluoropentan-2-amine (PubChem CID 79952744) has the molecular formula C11H16F3NS and a molecular weight of 251.32 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-5,5,5-trifluoropentan-2-amine.
| Compound Name | 1-(5-ethylthiophen-2-yl)-5,5,5-trifluoropentan-2-amine |
|---|---|
| PubChem CID | 79952744 |
| Molecular Formula | C11H16F3NS |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-5,5,5-trifluoropentan-2-amine |
| SMILES | CCc1ccc(CC(N)CCC(F)(F)F)s1 |
| InChI | InChI=1S/C11H16F3NS/c1-2-9-3-4-10(16-9)7-8(15)5-6-11(12,13)14/h3-4,8H,2,5-7,15H2,1H3 |
| InChIKey | BOKPIVKPUAPBKH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |