C13H23NS — CID 115842630
1-(5-ethylthiophen-2-yl)-3,3-dimethylpentan-2-amine (PubChem CID 115842630) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-3,3-dimethylpentan-2-amine.
| Compound Name | 1-(5-ethylthiophen-2-yl)-3,3-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 115842630 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-3,3-dimethylpentan-2-amine |
| SMILES | CCc1ccc(CC(N)C(C)(C)CC)s1 |
| InChI | InChI=1S/C13H23NS/c1-5-10-7-8-11(15-10)9-12(14)13(3,4)6-2/h7-8,12H,5-6,9,14H2,1-4H3 |
| InChIKey | YHQZSPTUCKUBDT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |