C13H21BrS — CID 83142800
2-[2-(bromomethyl)-3,3-dimethylbutyl]-5-ethylthiophene (PubChem CID 83142800) has the molecular formula C13H21BrS and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3,3-dimethylbutyl]-5-ethylthiophene.
| Compound Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]-5-ethylthiophene |
|---|---|
| PubChem CID | 83142800 |
| Molecular Formula | C13H21BrS |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]-5-ethylthiophene |
| SMILES | CCc1ccc(CC(CBr)C(C)(C)C)s1 |
| InChI | InChI=1S/C13H21BrS/c1-5-11-6-7-12(15-11)8-10(9-14)13(2,3)4/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | JIFQMVUBBLQCQB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|