C9H13F3N2S — CID 105215725
[3-(5-ethylthiophen-2-yl)-1,1,1-trifluoropropan-2-yl]hydrazine (PubChem CID 105215725) has the molecular formula C9H13F3N2S and a molecular weight of 238.28 g/mol. Its IUPAC name is [3-(5-ethylthiophen-2-yl)-1,1,1-trifluoropropan-2-yl]hydrazine.
| Compound Name | [3-(5-ethylthiophen-2-yl)-1,1,1-trifluoropropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105215725 |
| Molecular Formula | C9H13F3N2S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [3-(5-ethylthiophen-2-yl)-1,1,1-trifluoropropan-2-yl]hydrazine |
| SMILES | CCc1ccc(CC(NN)C(F)(F)F)s1 |
| InChI | InChI=1S/C9H13F3N2S/c1-2-6-3-4-7(15-6)5-8(14-13)9(10,11)12/h3-4,8,14H,2,5,13H2,1H3 |
| InChIKey | ANDNGFNUZRHYCR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|