C11H17F3N2S — CID 105249000
[1-(5-ethylthiophen-2-yl)-5,5,5-trifluoropentan-2-yl]hydrazine (PubChem CID 105249000) has the molecular formula C11H17F3N2S and a molecular weight of 266.33 g/mol. Its IUPAC name is [1-(5-ethylthiophen-2-yl)-5,5,5-trifluoropentan-2-yl]hydrazine.
| Compound Name | [1-(5-ethylthiophen-2-yl)-5,5,5-trifluoropentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105249000 |
| Molecular Formula | C11H17F3N2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [1-(5-ethylthiophen-2-yl)-5,5,5-trifluoropentan-2-yl]hydrazine |
| SMILES | CCc1ccc(CC(CCC(F)(F)F)NN)s1 |
| InChI | InChI=1S/C11H17F3N2S/c1-2-9-3-4-10(17-9)7-8(16-15)5-6-11(12,13)14/h3-4,8,16H,2,5-7,15H2,1H3 |
| InChIKey | KHUDBJYJKKLICI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|