C15H18F2N2S — CID 105223143
[1-(2,4-difluorophenyl)-3-(5-ethylthiophen-2-yl)propan-2-yl]hydrazine (PubChem CID 105223143) has the molecular formula C15H18F2N2S and a molecular weight of 296.39 g/mol. Its IUPAC name is [1-(2,4-difluorophenyl)-3-(5-ethylthiophen-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(2,4-difluorophenyl)-3-(5-ethylthiophen-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105223143 |
| Molecular Formula | C15H18F2N2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [1-(2,4-difluorophenyl)-3-(5-ethylthiophen-2-yl)propan-2-yl]hydrazine |
| SMILES | CCc1ccc(CC(Cc2ccc(F)cc2F)NN)s1 |
| InChI | InChI=1S/C15H18F2N2S/c1-2-13-5-6-14(20-13)9-12(19-18)7-10-3-4-11(16)8-15(10)17/h3-6,8,12,19H,2,7,9,18H2,1H3 |
| InChIKey | DXWJPHWNUGYFTA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|