C15H24OS — CID 114967772
1-(5-ethylthiophen-2-yl)-4,5,5-trimethylhexan-2-one (PubChem CID 114967772) has the molecular formula C15H24OS and a molecular weight of 252.42 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-4,5,5-trimethylhexan-2-one.
| Compound Name | 1-(5-ethylthiophen-2-yl)-4,5,5-trimethylhexan-2-one |
|---|---|
| PubChem CID | 114967772 |
| Molecular Formula | C15H24OS |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-4,5,5-trimethylhexan-2-one |
| SMILES | CCc1ccc(CC(=O)CC(C)C(C)(C)C)s1 |
| InChI | InChI=1S/C15H24OS/c1-6-13-7-8-14(17-13)10-12(16)9-11(2)15(3,4)5/h7-8,11H,6,9-10H2,1-5H3 |
| InChIKey | SUYYLOOKBBXOKP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |