C9H14N2OS — CID 64990824
2-amino-3-(5-ethylthiophen-2-yl)propanamide (PubChem CID 64990824) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-amino-3-(5-ethylthiophen-2-yl)propanamide.
| Compound Name | 2-amino-3-(5-ethylthiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 64990824 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-amino-3-(5-ethylthiophen-2-yl)propanamide |
| SMILES | CCc1ccc(CC(N)C(N)=O)s1 |
| InChI | InChI=1S/C9H14N2OS/c1-2-6-3-4-7(13-6)5-8(10)9(11)12/h3-4,8H,2,5,10H2,1H3,(H2,11,12) |
| InChIKey | VPMWQOVDMOTTIK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |