C11H19NO2S2 — CID 115842626
1-(5-ethylthiophen-2-yl)-3-methylsulfonylbutan-2-amine (PubChem CID 115842626) has the molecular formula C11H19NO2S2 and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-3-methylsulfonylbutan-2-amine.
| Compound Name | 1-(5-ethylthiophen-2-yl)-3-methylsulfonylbutan-2-amine |
|---|---|
| PubChem CID | 115842626 |
| Molecular Formula | C11H19NO2S2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-3-methylsulfonylbutan-2-amine |
| SMILES | CCc1ccc(CC(N)C(C)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C11H19NO2S2/c1-4-9-5-6-10(15-9)7-11(12)8(2)16(3,13)14/h5-6,8,11H,4,7,12H2,1-3H3 |
| InChIKey | RGBYDWRXBGWTIQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |