C15H19NO2S2 — CID 115842561
2-(5-ethylthiophen-2-yl)-1-(4-methylsulfonylphenyl)ethanamine (PubChem CID 115842561) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 2-(5-ethylthiophen-2-yl)-1-(4-methylsulfonylphenyl)ethanamine.
| Compound Name | 2-(5-ethylthiophen-2-yl)-1-(4-methylsulfonylphenyl)ethanamine |
|---|---|
| PubChem CID | 115842561 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-(5-ethylthiophen-2-yl)-1-(4-methylsulfonylphenyl)ethanamine |
| SMILES | CCc1ccc(CC(N)c2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C15H19NO2S2/c1-3-12-6-7-13(19-12)10-15(16)11-4-8-14(9-5-11)20(2,17)18/h4-9,15H,3,10,16H2,1-2H3 |
| InChIKey | PXBVIHVMQGUIDO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |