C9H14ClNO3S — CID 142503487
(2R)-2-amino-2-(4-methylsulfonylphenyl)ethanol;hydrochloride (PubChem CID 142503487) has the molecular formula C9H14ClNO3S and a molecular weight of 251.73 g/mol. Its IUPAC name is (2R)-2-amino-2-(4-methylsulfonylphenyl)ethanol;hydrochloride.
| Compound Name | (2R)-2-amino-2-(4-methylsulfonylphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 142503487 |
| Molecular Formula | C9H14ClNO3S |
| Molecular Weight | 251.73 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | (2R)-2-amino-2-(4-methylsulfonylphenyl)ethanol;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc([C@@H](N)CO)cc1.Cl |
| InChI | InChI=1S/C9H13NO3S.ClH/c1-14(12,13)8-4-2-7(3-5-8)9(10)6-11;/h2-5,9,11H,6,10H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | SZOYRSVTDFSLHS-FVGYRXGTSA-N |
| XLogP | 0.50 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.73 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |