C10H12F3NO2S — CID 171198392
(1R)-3,3,3-trifluoro-1-(4-methylsulfonylphenyl)propan-1-amine (PubChem CID 171198392) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is (1R)-3,3,3-trifluoro-1-(4-methylsulfonylphenyl)propan-1-amine.
| Compound Name | (1R)-3,3,3-trifluoro-1-(4-methylsulfonylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 171198392 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | (1R)-3,3,3-trifluoro-1-(4-methylsulfonylphenyl)propan-1-amine |
| SMILES | CS(=O)(=O)c1ccc([C@H](N)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3NO2S/c1-17(15,16)8-4-2-7(3-5-8)9(14)6-10(11,12)13/h2-5,9H,6,14H2,1H3/t9-/m1/s1 |
| InChIKey | XDOLZXAGMLCDFU-SECBINFHSA-N |
| XLogP | 2.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |