C10H16ClNO2S — CID 162344090
(1S)-1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride (PubChem CID 162344090) has the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. Its IUPAC name is (1S)-1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 162344090 |
| Molecular Formula | C10H16ClNO2S |
| Molecular Weight | 249.76 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (1S)-1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride |
| SMILES | CC[C@H](N)c1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C10H15NO2S.ClH/c1-3-10(11)8-4-6-9(7-5-8)14(2,12)13;/h4-7,10H,3,11H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | QQFMYVCGLZUZMC-PPHPATTJSA-N |
| XLogP | 1.92 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |