C12H18ClNO2S — CID 171217926
(1S)-3-methyl-1-(4-methylsulfonylphenyl)but-3-en-1-amine;hydrochloride (PubChem CID 171217926) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is (1S)-3-methyl-1-(4-methylsulfonylphenyl)but-3-en-1-amine;hydrochloride.
| Compound Name | (1S)-3-methyl-1-(4-methylsulfonylphenyl)but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171217926 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (1S)-3-methyl-1-(4-methylsulfonylphenyl)but-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)C[C@H](N)c1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C12H17NO2S.ClH/c1-9(2)8-12(13)10-4-6-11(7-5-10)16(3,14)15;/h4-7,12H,1,8,13H2,2-3H3;1H/t12-;/m0./s1 |
| InChIKey | QPKREKMGXNDZER-YDALLXLXSA-N |
| XLogP | 2.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|