C11H15NO4S — CID 171238940
methyl (3S)-3-amino-3-(4-methylsulfonylphenyl)propanoate (PubChem CID 171238940) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(4-methylsulfonylphenyl)propanoate.
| Compound Name | methyl (3S)-3-amino-3-(4-methylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 171238940 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl (3S)-3-amino-3-(4-methylsulfonylphenyl)propanoate |
| SMILES | COC(=O)C[C@H](N)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H15NO4S/c1-16-11(13)7-10(12)8-3-5-9(6-4-8)17(2,14)15/h3-6,10H,7,12H2,1-2H3/t10-/m0/s1 |
| InChIKey | JOHGQPVQOFSGIB-JTQLQIEISA-N |
| XLogP | 0.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |