C11H16ClNO4S — CID 171245659
methyl (3R)-3-amino-3-(4-methylsulfonylphenyl)propanoate;hydrochloride (PubChem CID 171245659) has the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(4-methylsulfonylphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(4-methylsulfonylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171245659 |
| Molecular Formula | C11H16ClNO4S |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | methyl (3R)-3-amino-3-(4-methylsulfonylphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C11H15NO4S.ClH/c1-16-11(13)7-10(12)8-3-5-9(6-4-8)17(2,14)15;/h3-6,10H,7,12H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | RPQNKSJEUMTXEQ-HNCPQSOCSA-N |
| XLogP | 1.07 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |