C10H15ClFNO2S — CID 171198397
(1R)-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride (PubChem CID 171198397) has the molecular formula C10H15ClFNO2S and a molecular weight of 267.75 g/mol. Its IUPAC name is (1R)-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171198397 |
| Molecular Formula | C10H15ClFNO2S |
| Molecular Weight | 267.75 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | (1R)-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc([C@H](N)CCF)cc1.Cl |
| InChI | InChI=1S/C10H14FNO2S.ClH/c1-15(13,14)9-4-2-8(3-5-9)10(12)6-7-11;/h2-5,10H,6-7,12H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | JXDKIQSPAYBCHN-HNCPQSOCSA-N |
| XLogP | 1.87 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.75 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |