C10H13F2NO2S — CID 171312805
(1S)-3,3-difluoro-1-(4-methylsulfonylphenyl)propan-1-amine (PubChem CID 171312805) has the molecular formula C10H13F2NO2S and a molecular weight of 249.28 g/mol. Its IUPAC name is (1S)-3,3-difluoro-1-(4-methylsulfonylphenyl)propan-1-amine.
| Compound Name | (1S)-3,3-difluoro-1-(4-methylsulfonylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 171312805 |
| Molecular Formula | C10H13F2NO2S |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (1S)-3,3-difluoro-1-(4-methylsulfonylphenyl)propan-1-amine |
| SMILES | CS(=O)(=O)c1ccc([C@@H](N)CC(F)F)cc1 |
| InChI | InChI=1S/C10H13F2NO2S/c1-16(14,15)8-4-2-7(3-5-8)9(13)6-10(11)12/h2-5,9-10H,6,13H2,1H3/t9-/m0/s1 |
| InChIKey | OZNBPKXAPBYVQL-VIFPVBQESA-N |
| XLogP | 1.75 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |