C12H20ClNO2S — CID 171198410
(1R)-2-methyl-1-(4-methylsulfonylphenyl)butan-1-amine;hydrochloride (PubChem CID 171198410) has the molecular formula C12H20ClNO2S and a molecular weight of 277.82 g/mol. Its IUPAC name is (1R)-2-methyl-1-(4-methylsulfonylphenyl)butan-1-amine;hydrochloride.
| Compound Name | (1R)-2-methyl-1-(4-methylsulfonylphenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171198410 |
| Molecular Formula | C12H20ClNO2S |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (1R)-2-methyl-1-(4-methylsulfonylphenyl)butan-1-amine;hydrochloride |
| SMILES | CCC(C)[C@@H](N)c1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C12H19NO2S.ClH/c1-4-9(2)12(13)10-5-7-11(8-6-10)16(3,14)15;/h5-9,12H,4,13H2,1-3H3;1H/t9?,12-;/m1./s1 |
| InChIKey | HWSKRMKBQDOORN-ZHWMGRLRSA-N |
| XLogP | 2.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |