C11H18N2O2S — CID 116933127
2-methyl-1-(4-methylsulfonylphenyl)propane-1,3-diamine (PubChem CID 116933127) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-methyl-1-(4-methylsulfonylphenyl)propane-1,3-diamine.
| Compound Name | 2-methyl-1-(4-methylsulfonylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116933127 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-methyl-1-(4-methylsulfonylphenyl)propane-1,3-diamine |
| SMILES | CC(CN)C(N)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H18N2O2S/c1-8(7-12)11(13)9-3-5-10(6-4-9)16(2,14)15/h3-6,8,11H,7,12-13H2,1-2H3 |
| InChIKey | PCGJNMRDECKSJK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |