C11H15F2NO2S — CID 166062873
(1S,2S,3R)-1,3-difluoro-1-(4-methylsulfonylphenyl)butan-2-amine (PubChem CID 166062873) has the molecular formula C11H15F2NO2S and a molecular weight of 263.31 g/mol. Its IUPAC name is (1S,2S,3R)-1,3-difluoro-1-(4-methylsulfonylphenyl)butan-2-amine.
| Compound Name | (1S,2S,3R)-1,3-difluoro-1-(4-methylsulfonylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 166062873 |
| Molecular Formula | C11H15F2NO2S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (1S,2S,3R)-1,3-difluoro-1-(4-methylsulfonylphenyl)butan-2-amine |
| SMILES | C[C@@H](F)[C@H](N)[C@@H](F)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H15F2NO2S/c1-7(12)11(14)10(13)8-3-5-9(6-4-8)17(2,15)16/h3-7,10-11H,14H2,1-2H3/t7-,10+,11+/m1/s1 |
| InChIKey | CRSYAPOUCHVWQU-GGVZMXCHSA-N |
| XLogP | 1.79 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |