C10H15NO4S — CID 12936087
(1R,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol (PubChem CID 12936087) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol.
| Compound Name | (1R,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 12936087 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (1R,2S)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)[C@@H](N)CO)cc1 |
| InChI | InChI=1S/C10H15NO4S/c1-16(14,15)8-4-2-7(3-5-8)10(13)9(11)6-12/h2-5,9-10,12-13H,6,11H2,1H3/t9-,10+/m0/s1 |
| InChIKey | CIAZEFCFQFQJLB-VHSXEESVSA-N |
| XLogP | -0.56 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |