About (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane
(1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane (PubChem CID 162082008) has the molecular formula C15H27NO4S
and a molecular weight of 317.45 g/mol. Its IUPAC name is (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane.
Molecular Properties
| Compound Name | (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane |
| PubChem CID | 162082008 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane |
| SMILES | CCC.CCN[C@H](CO)[C@H](O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19NO4S.C3H8/c1-3-13-11(8-14)12(15)9-4-6-10(7-5-9)18(2,16)17;1-3-2/h4-7,11-15H,3,8H2,1-2H3;3H2,1-2H3/t11-,12-;/m1./s1 |
| InChIKey | ZCLUJFATGARSKD-MNMPKAIFSA-N |
| XLogP | 1.51 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane?
The IUPAC name of (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane (CID 162082008) is (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane.
What is the SMILES notation for (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane?
The canonical SMILES for (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane is CCC.CCN[C@H](CO)[C@H](O)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane?
The InChIKey is ZCLUJFATGARSKD-MNMPKAIFSA-N. The full InChI is InChI=1S/C12H19NO4S.C3H8/c1-3-13-11(8-14)12(15)9-4-6-10(7-5-9)18(2,16)17;1-3-2/h4-7,11-15H,3,8H2,1-2H3;3H2,1-2H3/t11-,12-;/m1./s1.
What are the key properties of (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane?
(1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane has a molecular weight of 317.45 g/mol, XLogP of 1.51, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-(ethylamino)-1-(4-methylsulfonylphenyl)propane-1,3-diol;propane is sourced from PubChem (CID 162082008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).