C28H47Cl2NO7S — CID 70470483
2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide;hexadecanoic acid (PubChem CID 70470483) has the molecular formula C28H47Cl2NO7S and a molecular weight of 612.66 g/mol. Its IUPAC name is 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide;hexadecanoic acid.
| Compound Name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide;hexadecanoic acid |
|---|---|
| PubChem CID | 70470483 |
| Molecular Formula | C28H47Cl2NO7S |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide;hexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.CS(=O)(=O)c1ccc([C@@H](O)[C@@H](CO)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H32O2.C12H15Cl2NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-15H2,1H3,(H,17,18);2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t;9-,10-/m.1/s1 |
| InChIKey | SUJRTGQJFMZZKI-SZYJBGPHSA-N |
| XLogP | 5.96 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|