C13H16Cl2N2O7S — CID 88666679
2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide;2-sulfanylacetic acid (PubChem CID 88666679) has the molecular formula C13H16Cl2N2O7S and a molecular weight of 415.25 g/mol. Its IUPAC name is 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide;2-sulfanylacetic acid.
| Compound Name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide;2-sulfanylacetic acid |
|---|---|
| PubChem CID | 88666679 |
| Molecular Formula | C13H16Cl2N2O7S |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide;2-sulfanylacetic acid |
| SMILES | O=C(N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1)C(Cl)Cl.O=C(O)CS |
| InChI | InChI=1S/C11H12Cl2N2O5.C2H4O2S/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20;3-2(4)1-5/h1-4,8-10,16-17H,5H2,(H,14,18);5H,1H2,(H,3,4)/t8-,9-;/m1./s1 |
| InChIKey | XQZRNKWXFSVIJE-VTLYIQCISA-N |
| XLogP | 0.91 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|