C11H13Cl2N2NaO5 — CID 174959839
sodium;2,2-dichloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide;hydride (PubChem CID 174959839) has the molecular formula C11H13Cl2N2NaO5 and a molecular weight of 347.13 g/mol. Its IUPAC name is sodium;2,2-dichloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide;hydride.
| Compound Name | sodium;2,2-dichloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide;hydride |
|---|---|
| PubChem CID | 174959839 |
| Molecular Formula | C11H13Cl2N2NaO5 |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | sodium;2,2-dichloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide;hydride |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)C(Cl)Cl.[H-].[Na+] |
| InChI | InChI=1S/C11H12Cl2N2O5.Na.H/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20;;/h1-4,8-10,16-17H,5H2,(H,14,18);;/q;+1;-1 |
| InChIKey | OKGJKHSNJBDMTQ-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|