C11H13ClN2O6 — CID 170454742
2-chloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-hydroxyacetamide (PubChem CID 170454742) has the molecular formula C11H13ClN2O6 and a molecular weight of 304.69 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-hydroxyacetamide.
| Compound Name | 2-chloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 170454742 |
| Molecular Formula | C11H13ClN2O6 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-chloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-hydroxyacetamide |
| SMILES | O=C(N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1)C(O)Cl |
| InChI | InChI=1S/C11H13ClN2O6/c12-10(17)11(18)13-8(5-15)9(16)6-1-3-7(4-2-6)14(19)20/h1-4,8-10,15-17H,5H2,(H,13,18)/t8-,9-,10?/m1/s1 |
| InChIKey | HTHASRYKCQJSFT-MGRQHWMJSA-N |
| XLogP | -0.34 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|