C13H15N2O7- — CID 7025313
4-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-4-oxobutanoate (PubChem CID 7025313) has the molecular formula C13H15N2O7- and a molecular weight of 311.27 g/mol. Its IUPAC name is 4-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-4-oxobutanoate.
| Compound Name | 4-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7025313 |
| Molecular Formula | C13H15N2O7- |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-4-oxobutanoate |
| SMILES | O=C([O-])CCC(=O)N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H16N2O7/c16-7-10(14-11(17)5-6-12(18)19)13(20)8-1-3-9(4-2-8)15(21)22/h1-4,10,13,16,20H,5-7H2,(H,14,17)(H,18,19)/p-1/t10-,13-/m1/s1 |
| InChIKey | VFAMVSYUKUIFGL-ZWNOBZJWSA-M |
| XLogP | -1.36 |
| TPSA | 152.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|