C14H15N5O7 — CID 19521685
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 19521685) has the molecular formula C14H15N5O7 and a molecular weight of 365.30 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-(3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-(3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19521685 |
| Molecular Formula | C14H15N5O7 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccc([N+](=O)[O-])n1)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H15N5O7/c20-8-11(14(22)9-1-3-10(4-2-9)18(23)24)15-13(21)7-17-6-5-12(16-17)19(25)26/h1-6,11,14,20,22H,7-8H2,(H,15,21) |
| InChIKey | NYGNFDPGDDYTKU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 173.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|