C16H17F3N4O5 — CID 19519258
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19519258) has the molecular formula C16H17F3N4O5 and a molecular weight of 402.33 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19519258 |
| Molecular Formula | C16H17F3N4O5 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17F3N4O5/c1-9-6-13(16(17,18)19)21-22(9)7-14(25)20-12(8-24)15(26)10-2-4-11(5-3-10)23(27)28/h2-6,12,15,24,26H,7-8H2,1H3,(H,20,25) |
| InChIKey | GOIHCHSUJYJXAF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|