C18H20F2N4O5 — CID 19530338
2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide (PubChem CID 19530338) has the molecular formula C18H20F2N4O5 and a molecular weight of 410.38 g/mol. Its IUPAC name is 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide.
| Compound Name | 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 19530338 |
| Molecular Formula | C18H20F2N4O5 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
| SMILES | O=C(Cn1nc(C2CC2)cc1C(F)F)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20F2N4O5/c19-18(20)15-7-13(10-1-2-10)22-23(15)8-16(26)21-14(9-25)17(27)11-3-5-12(6-4-11)24(28)29/h3-7,10,14,17-18,25,27H,1-2,8-9H2,(H,21,26) |
| InChIKey | HALRBWFNYBDCAC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|