C19H21F3N4O5 — CID 19535135
2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide (PubChem CID 19535135) has the molecular formula C19H21F3N4O5 and a molecular weight of 442.39 g/mol. Its IUPAC name is 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide.
| Compound Name | 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 19535135 |
| Molecular Formula | C19H21F3N4O5 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
| SMILES | CC(C(=O)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)n1nc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C19H21F3N4O5/c1-10(25-15(11-2-3-11)8-16(24-25)19(20,21)22)18(29)23-14(9-27)17(28)12-4-6-13(7-5-12)26(30)31/h4-8,10-11,14,17,27-28H,2-3,9H2,1H3,(H,23,29) |
| InChIKey | XOGBRLIZLZMYOB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|