C17H17ClF4N4O5 — CID 19535865
2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide (PubChem CID 19535865) has the molecular formula C17H17ClF4N4O5 and a molecular weight of 468.79 g/mol. Its IUPAC name is 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide.
| Compound Name | 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 19535865 |
| Molecular Formula | C17H17ClF4N4O5 |
| Molecular Weight | 468.79 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
| SMILES | CC(C(=O)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)n1nc(C(F)F)c(Cl)c1C(F)F |
| InChI | InChI=1S/C17H17ClF4N4O5/c1-7(25-13(16(21)22)11(18)12(24-25)15(19)20)17(29)23-10(6-27)14(28)8-2-4-9(5-3-8)26(30)31/h2-5,7,10,14-16,27-28H,6H2,1H3,(H,23,29) |
| InChIKey | FHWIRQDKMPPWPE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|