C12H15ClN2O5 — CID 23275537
2-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide (PubChem CID 23275537) has the molecular formula C12H15ClN2O5 and a molecular weight of 302.71 g/mol. Its IUPAC name is 2-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide.
| Compound Name | 2-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 23275537 |
| Molecular Formula | C12H15ClN2O5 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
| SMILES | CC(Cl)C(=O)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15ClN2O5/c1-7(13)12(18)14-10(6-16)11(17)8-2-4-9(5-3-8)15(19)20/h2-5,7,10-11,16-17H,6H2,1H3,(H,14,18) |
| InChIKey | KXPLIVOKXDGRQS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|